| 3/29/2024 | 35069190 | Keo dính (TPHH:Ethyl acetate (141-78-6) 30-40%, Hexane (110-54-3) 15%,Cyclohexane (110-82-7) 15-25%, Methanol (67-56-1) <5%)PENGUIN CEMENT #321,14KG/CAN,hàng mới 100% | XXXXXXXXXX | 364 | KGM | 1878.24 | Japan | NA |
| 3/29/2024 | 35069190 | glue (component made from phenol resin; PR-FC-40 (18L/ barrel) raw materials for production (main ingredients: Phenol Resin: 30-50%; methanol: 40-60%; Phenol: 1-5 %;Water: 10-20%) | XXXXXXXXXX | 8 | BBL | 2012.952 | Japan | NA |
| 3/29/2024 | 39053090 | DENKA POVAL PVA B-33 - POLYVINYL ALCOHOL, granular (1bag=20kg) Acetic Acid Ethenyl Ester co-Polymer with Ethenol 25213-24-5, Methanol 67-56-1, NLSX glue, with product label, NH :DENKA,100% new | XXXXXXXXXX | 5 | TNE | 13000 | Japan | NA |
| 3/28/2024 | 38140000 | -#&Solvent TH-73 MAKEUP INK: 1 bottle/kg, for HITACHI inkjet printers. TP:2-butanone:80-90%; Ethanol:1-10%; Methanol:1-3%;1 -butanol:1-3%.manufacturer: Hitachi, 100% new product | XXXXXXXXXX | 12 | UNK | 472.0032 | Japan | NA |
| 3/28/2024 | 35069190 | FCHF-TD-174#&Chemlok 608 rubber adhesive contains Methanol 40%;Ethyl alcohol 25%;Isopropanol 5%. New 100%. | XXXXXXXXXX | 5.4 | KGM | 1581.8868 | Japan | NA |
| 3/27/2024 | 29319090 | RM1506011#&Epoxy silicone compound (KBM-403/ Dip Coating Liquid Silicon), used in the production of eyeglass lenses. CTHH:(C2H503)SiC3H6OCH2CHOCH2, CAS: 2530-83-8; Methanol(impurity),CAS:67-56-1(18 kg/can) | XXXXXXXXXX | 4 | UNL | 718.408 | Japan | NA |
| 3/26/2024 | 38140000 | MAMOI-073#&Solvent for removing water-based paint DA2000 (16 liters/box) Methanol 15% 67-56-1;Ethyl acetate 6% 141-78-6;Butyl acetate 6% 123-86-4;Toluene 62% 108 -88-3;Acetone 6% 67-64-1 | XXXXXXXXXX | 2 | UNK | 159.6798 | Japan | NA |
| 3/26/2024 | 38140000 | WATER_PAINT_500GB_MP6484#&Water to clean stains on shoes, composed of water and methanol 500GB_MP6484 | XXXXXXXXXX | 1 | UNA | 22.3308 | Japan | NA |
| 3/26/2024 | 35069900 | NVLSP04#&POLYTHICK 470-S adhesive (Acrylic resin 40%, Cyclohexane 11%, Toluene 36%, Ethyl acetate 9%, Methanol 4%) 037297/. New 100% | XXXXXXXXXX | 225000 | GRM | 2970 | Japan | NA |
| 3/26/2024 | 38140000 | WATER_PAINT_500G_OM0000#&Water to clean stains on shoes, composed of water and methanol | XXXXXXXXXX | 2 | UNA | 44.6616 | Japan | NA |